Ampicillin Ip
Ampicillin is used to treat certain infections that are caused by bacteria such as meningitis (infection of the thin layers that cover and protect the brain and spinal cord); and infections of the throat, sinuses, lungs, reproductive organs, urinary tract, and gastrointestinal tract (includes the mouth, stomach, or intestines).
United States
$13
per month
India
$1
per month
You save
−91%save $12/mo · 91% cheaper
Drag to rotate · 3D structureC16H19N3O4S
SMILES: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)C
Compare the price
US price$13per month
India price$1per month
You save$1291% less
Based on 30 EAs per month. US $0.44 vs India $0.04 per EA.
Total over 1 periodSave $12$13 → $1